Difference between revisions of "Digalactosylceramide-sulfate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12483 == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) * inchi-key: ** nofnclgcujjpku-uhfffaoys...")
(Created page with "Category:metabolite == Metabolite Digalactosylceramide-sulfate == * common-name: ** a digalactosylceramide sulfate == Reaction(s) known to consume the compound == == React...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12483 ==
+
== Metabolite Digalactosylceramide-sulfate ==
 
* common-name:
 
* common-name:
** 1,7-dimethylurate
+
** a digalactosylceramide sulfate
* smiles:
 
** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
 
* inchi-key:
 
** nofnclgcujjpku-uhfffaoysa-n
 
* molecular-weight:
 
** 196.165
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11520]]
+
* [[RXN-18303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,7-dimethylurate}}
+
{{#set: common-name=a digalactosylceramide sulfate}}
{{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}}
 
{{#set: molecular-weight=196.165}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Digalactosylceramide-sulfate

  • common-name:
    • a digalactosylceramide sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality