Difference between revisions of "CPD-3707"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-PRENYL-L-CYSTEINE == * common-name: ** s-prenyl-l-cysteine * smiles: ** cc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** ulhwznasvjioem-zetcq...") |
(Created page with "Category:metabolite == Metabolite CD-SP-2Fe2S-Complex == * common-name: ** a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex == Reaction(s) known to consume the...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CD-SP-2Fe2S-Complex == |
* common-name: | * common-name: | ||
− | ** | + | ** a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14387]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex}} |
− | |||
− |
Revision as of 11:18, 15 January 2021
Contents
Metabolite CD-SP-2Fe2S-Complex
- common-name:
- a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.