Difference between revisions of "CPD-12126"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7222 == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
(Created page with "Category:metabolite == Metabolite CPD-369 == * common-name: ** l-iditol * smiles: ** c(c(c(c(c(o)co)o)o)o)o * inchi-key: ** fbpfztcfmrresa-untfvmjosa-n * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7222 ==
+
== Metabolite CPD-369 ==
 
* common-name:
 
* common-name:
** (2e)-dodec-2-enoyl-coa
+
** l-iditol
 
* smiles:
 
* smiles:
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
+
** c(c(c(c(c(o)co)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** irfyvbulxzmede-xcfippspsa-j
+
** fbpfztcfmrresa-untfvmjosa-n
 
* molecular-weight:
 
* molecular-weight:
** 943.792
+
** 182.173
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH5]]
+
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
* [[ECOAH5h]]
 
* [[ECOAH5m]]
 
* [[RXN-14262]]
 
* [[RXN-7931]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA120OR]]
+
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
* [[ECOAH5]]
 
* [[ECOAH5h]]
 
* [[ECOAH5m]]
 
* [[RXN-14262]]
 
* [[RXN-7931]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
+
{{#set: common-name=l-iditol}}
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
+
{{#set: inchi-key=inchikey=fbpfztcfmrresa-untfvmjosa-n}}
{{#set: molecular-weight=943.792}}
+
{{#set: molecular-weight=182.173}}

Revision as of 11:18, 15 January 2021

Metabolite CPD-369

  • common-name:
    • l-iditol
  • smiles:
    • c(c(c(c(c(o)co)o)o)o)o
  • inchi-key:
    • fbpfztcfmrresa-untfvmjosa-n
  • molecular-weight:
    • 182.173

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality