Difference between revisions of "MANNOSE-6P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(oc...")
(Created page with "Category:metabolite == Metabolite Nucleoside-Triphosphates == * common-name: ** a nucleoside triphosphate == Reaction(s) known to consume the compound == * [[2.7.4.10-RXN]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8291 ==
+
== Metabolite Nucleoside-Triphosphates ==
 
* common-name:
 
* common-name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** a nucleoside triphosphate
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
 
* inchi-key:
 
** mwrbnpkjoowzpw-nyvomtagsa-n
 
* molecular-weight:
 
** 744.043
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15036]]
+
* [[2.7.4.10-RXN]]
* [[RXN-15067]]
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
 +
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[RXN-14024]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[2.7.4.10-RXN]]
 +
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: common-name=a nucleoside triphosphate}}
{{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}}
 
{{#set: molecular-weight=744.043}}
 

Revision as of 11:18, 15 January 2021