Difference between revisions of "N-terminal-XPK"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14422 == * common-name: ** 3-oxo-icosatrienoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
(Created page with "Category:metabolite == Metabolite CIS-DELTA3-ENOYL-COA == * common-name: ** a (3z)-alkan-3-enoyl-coa == Reaction(s) known to consume the compound == * ENOYL-COA-DELTA-IS...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14422 ==
+
== Metabolite CIS-DELTA3-ENOYL-COA ==
 
* common-name:
 
* common-name:
** 3-oxo-icosatrienoyl-coa
+
** a (3z)-alkan-3-enoyl-coa
* smiles:
 
** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** dfyfqqxxtclfng-ubqhhbpxsa-j
 
* molecular-weight:
 
** 1065.958
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12994]]
+
* [[ENOYL-COA-DELTA-ISOM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13441]]
+
* [[ENOYL-COA-DELTA-ISOM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-icosatrienoyl-coa}}
+
{{#set: common-name=a (3z)-alkan-3-enoyl-coa}}
{{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}}
 
{{#set: molecular-weight=1065.958}}
 

Revision as of 11:19, 15 January 2021

Metabolite CIS-DELTA3-ENOYL-COA

  • common-name:
    • a (3z)-alkan-3-enoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality