Difference between revisions of "Uracil20-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE == * common-name: ** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CONIFERYL-ALCOHOL == |
* common-name: | * common-name: | ||
− | ** 1- | + | ** coniferyl alcohol |
+ | * smiles: | ||
+ | ** coc1(=cc(c=cco)=cc=c(o)1) | ||
+ | * inchi-key: | ||
+ | ** jmfrwrfflbvwsi-nscuhmnnsa-n | ||
+ | * molecular-weight: | ||
+ | ** 180.203 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17351]] |
− | * [[RXN- | + | * [[RXN-17352]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=coniferyl alcohol}} |
+ | {{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}} | ||
+ | {{#set: molecular-weight=180.203}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CONIFERYL-ALCOHOL
- common-name:
- coniferyl alcohol
- smiles:
- coc1(=cc(c=cco)=cc=c(o)1)
- inchi-key:
- jmfrwrfflbvwsi-nscuhmnnsa-n
- molecular-weight:
- 180.203