Difference between revisions of "CPD-19160"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-BUTYRYL-COA == * common-name: ** 2-methylbutanoyl-coa * smiles: ** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite Guanine9-in-tRNA == * common-name: ** a guanine9 in trna == Reaction(s) known to consume the compound == * RXN-12459 == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-BUTYRYL-COA ==
+
== Metabolite Guanine9-in-tRNA ==
 
* common-name:
 
* common-name:
** 2-methylbutanoyl-coa
+
** a guanine9 in trna
* smiles:
 
** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** lynvnydeqmmnmz-xgxnyeovsa-j
 
* molecular-weight:
 
** 847.62
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-MEBUCOA-FAD-RXN]]
+
* [[RXN-12459]]
* [[2KETO-3METHYLVALERATE-RXN]]
 
* [[MBCOA-DHLIPOAMIDE-RXN]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-MEBUCOA-FAD-RXN]]
 
* [[2KETO-3METHYLVALERATE-RXN]]
 
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
 
* [[MBCOA-DHLIPOAMIDE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylbutanoyl-coa}}
+
{{#set: common-name=a guanine9 in trna}}
{{#set: inchi-key=inchikey=lynvnydeqmmnmz-xgxnyeovsa-j}}
 
{{#set: molecular-weight=847.62}}
 

Revision as of 11:20, 15 January 2021

Metabolite Guanine9-in-tRNA

  • common-name:
    • a guanine9 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality