Difference between revisions of "CPD-597"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...") |
(Created page with "Category:metabolite == Metabolite DIPHTINE == * common-name: ** a diphthine-[translation elongation factor 2] == Reaction(s) known to consume the compound == * DIPHTINE-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIPHTINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a diphthine-[translation elongation factor 2] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DIPHTINE--AMMONIA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11373]] |
| + | * [[RXN-14326]] | ||
| + | * [[RXN-15776]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a diphthine-[translation elongation factor 2]}} |
| − | |||
| − | |||
Revision as of 08:24, 15 March 2021
Contents
Metabolite DIPHTINE
- common-name:
- a diphthine-[translation elongation factor 2]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a diphthine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
