Difference between revisions of "CARBAMOYL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...")
(Created page with "Category:metabolite == Metabolite CPD-17046 == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))(nc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FERULIC-ACID ==
+
== Metabolite CPD-17046 ==
 
* common-name:
 
* common-name:
** ferulate
+
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
 
* smiles:
 
* smiles:
** coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
+
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** ksebmyqbyztdhs-hwkanzrosa-m
+
** yjisldwviydioe-wgtgpsahsa-l
 
* molecular-weight:
 
* molecular-weight:
** 193.179
+
** 842.848
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6.2.1.34-RXN]]
+
* [[RXN-15681]]
* [[RXN-1121]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.73-RXN]]
+
* [[RXN-15680]]
* [[RXN-1104]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ferulate}}
+
{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
{{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}}
+
{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
{{#set: molecular-weight=193.179}}
+
{{#set: molecular-weight=842.848}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-17046

  • common-name:
    • 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
  • smiles:
    • c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • yjisldwviydioe-wgtgpsahsa-l
  • molecular-weight:
    • 842.848

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality