Difference between revisions of "DNA-Combined-With-Exogenous-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CREATINE-P == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] * inchi-key: ** drbbfclwyr...")
(Created page with "Category:metabolite == Metabolite CPD-17638 == * common-name: ** 7-hydroxylauroyl-coa * smiles: ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CREATINE-P ==
+
== Metabolite CPD-17638 ==
 
* common-name:
 
* common-name:
** nω-phosphocreatine
+
** 7-hydroxylauroyl-coa
 
* smiles:
 
* smiles:
** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
+
** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** drbbfclwyrjsjz-uhfffaoysa-l
+
** rxedusgpuqqzew-xirpngcasa-j
 
* molecular-weight:
 
* molecular-weight:
** 209.098
+
** 961.807
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CREATINE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CREATINE-KINASE-RXN]]
+
* [[RXN-12184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nω-phosphocreatine}}
+
{{#set: common-name=7-hydroxylauroyl-coa}}
{{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}}
{{#set: molecular-weight=209.098}}
+
{{#set: molecular-weight=961.807}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-17638

  • common-name:
    • 7-hydroxylauroyl-coa
  • smiles:
    • cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rxedusgpuqqzew-xirpngcasa-j
  • molecular-weight:
    • 961.807

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality