Difference between revisions of "CPD-396"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Guanine26-in-tRNA == * common-name: ** a guanine26 in trna == Reaction(s) known to consume the compound == * RXN-12375 * [[RXN-12377]...")
(Created page with "Category:metabolite == Metabolite CPD0-2244 == * common-name: ** (s)-3-hydroxydecanoyl-coa * smiles: ** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Guanine26-in-tRNA ==
+
== Metabolite CPD0-2244 ==
 
* common-name:
 
* common-name:
** a guanine26 in trna
+
** (s)-3-hydroxydecanoyl-coa
 +
* smiles:
 +
** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 +
* inchi-key:
 +
** hivsmyzamunfkz-pnpvfpmqsa-j
 +
* molecular-weight:
 +
** 933.753
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12375]]
+
* [[ECOAH4h]]
* [[RXN-12377]]
+
* [[HACD4h]]
 +
* [[RXN-12490]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ECOAH4h]]
 +
* [[HACD4h]]
 +
* [[RXN-13616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a guanine26 in trna}}
+
{{#set: common-name=(s)-3-hydroxydecanoyl-coa}}
 +
{{#set: inchi-key=inchikey=hivsmyzamunfkz-pnpvfpmqsa-j}}
 +
{{#set: molecular-weight=933.753}}

Revision as of 08:24, 15 March 2021

Metabolite CPD0-2244

  • common-name:
    • (s)-3-hydroxydecanoyl-coa
  • smiles:
    • cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • hivsmyzamunfkz-pnpvfpmqsa-j
  • molecular-weight:
    • 933.753

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality