Difference between revisions of "Feruloyl-polysaccharides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15977 == * common-name: ** 1,2-dioleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o * inchi-key: ** a...")
(Created page with "Category:metabolite == Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs == * common-name: ** a (2e,7z)-hexadeca-2,7-dienoyl-[acp] == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15977 ==
+
== Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs ==
 
* common-name:
 
* common-name:
** 1,2-dioleoylglycerol
+
** a (2e,7z)-hexadeca-2,7-dienoyl-[acp]
* smiles:
 
** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o
 
* inchi-key:
 
** afshuzfnmvjnkx-llwmboqksa-n
 
* molecular-weight:
 
** 620.995
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16624]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15090]]
+
* [[RXN-16623]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,2-dioleoylglycerol}}
+
{{#set: common-name=a (2e,7z)-hexadeca-2,7-dienoyl-[acp]}}
{{#set: inchi-key=inchikey=afshuzfnmvjnkx-llwmboqksa-n}}
 
{{#set: molecular-weight=620.995}}
 

Revision as of 08:24, 15 March 2021

Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs

  • common-name:
    • a (2e,7z)-hexadeca-2,7-dienoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (2e,7z)-hexadeca-2,7-dienoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.