Difference between revisions of "Charged-PRO-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...")
(Created page with "Category:metabolite == Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU == * common-name: ** a lactotetraosylceramide == Reaction(s) known to consume the compound == * GAL...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-181 ==
+
== Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU ==
 
* common-name:
 
* common-name:
** 4-methylumbelliferyl acetate
+
** a lactotetraosylceramide
* smiles:
 
** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o)
 
* inchi-key:
 
** hxvzgascdagaps-uhfffaoysa-n
 
* molecular-weight:
 
** 218.209
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.1.56-RXN]]
+
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylumbelliferyl acetate}}
+
{{#set: common-name=a lactotetraosylceramide}}
{{#set: inchi-key=inchikey=hxvzgascdagaps-uhfffaoysa-n}}
 
{{#set: molecular-weight=218.209}}
 

Revision as of 08:24, 15 March 2021

Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU

  • common-name:
    • a lactotetraosylceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality