Difference between revisions of "Charged-PRO-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
(Created page with "Category:metabolite == Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU == * common-name: ** a lactotetraosylceramide == Reaction(s) known to consume the compound == * GAL...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU == |
* common-name: | * common-name: | ||
− | ** | + | ** a lactotetraosylceramide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a lactotetraosylceramide}} |
− | |||
− |
Revision as of 08:24, 15 March 2021
Contents
Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU
- common-name:
- a lactotetraosylceramide