Difference between revisions of "BILIVERDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HG+2 == * common-name: ** hg2+ * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffaoysa-n * molecular-weight: ** 200.59 == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-17375 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol * smiles: ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17375 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rcalbbvhqnuwno-osfdyrcisa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 650.978 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16121]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rcalbbvhqnuwno-osfdyrcisa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=650.978}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-17375
- common-name:
- 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
- smiles:
- c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o
- inchi-key:
- rcalbbvhqnuwno-osfdyrcisa-n
- molecular-weight:
- 650.978
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
