Difference between revisions of "23S-rRNA-N7-methylguanine-2069"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SINAPALDEHYDE == * common-name: ** sinapaldehyde * smiles: ** coc1(c=c(c=cc=o)c=c(oc)c(o)=1) * inchi-key: ** cdicdsogtrchmg-onegzznksa-n...") |
(Created page with "Category:metabolite == Metabolite N5-Formyl-THF-Glu-N == * common-name: ** an (6s)-n5-formyl-tetrahydrofolate == Reaction(s) known to consume the compound == * 5-FORMYL-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N5-Formyl-THF-Glu-N == |
* common-name: | * common-name: | ||
| − | ** | + | ** an (6s)-n5-formyl-tetrahydrofolate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[5-FORMYL-THF-CYCLO-LIGASE-RXN]] |
| − | + | * [[RXN-6341]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-6341]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an (6s)-n5-formyl-tetrahydrofolate}} |
| − | |||
| − | |||
Revision as of 08:25, 15 March 2021
Contents
Metabolite N5-Formyl-THF-Glu-N
- common-name:
- an (6s)-n5-formyl-tetrahydrofolate
