Difference between revisions of "MRNA-Adenines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...")
(Created page with "Category:metabolite == Metabolite HEPARIN-GLUCOSAMINE-3-O-SULFATE == * common-name: ** a [heparan sulfate]-α-d-glucosamine 3-sulfate == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHINE ==
+
== Metabolite HEPARIN-GLUCOSAMINE-3-O-SULFATE ==
 
* common-name:
 
* common-name:
** xanthine
+
** a [heparan sulfate]-α-d-glucosamine 3-sulfate
* smiles:
 
** c12(nc(=o)nc(c=1n=cn2)=o)
 
* inchi-key:
 
** lrfvtywoqmyalw-uhfffaoysa-n
 
* molecular-weight:
 
** 152.112
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-901]]
 
* [[XANTHINE-OXIDASE-RXN]]
 
* [[XNDH]]
 
* [[XPPRT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GUANINE-DEAMINASE-RXN]]
+
* [[2.8.2.30-RXN]]
* [[RXN-7682]]
 
* [[RXN0-363]]
 
* [[RXN0-901]]
 
* [[XANDH]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
* [[XPPRT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthine}}
+
{{#set: common-name=a [heparan sulfate]-α-d-glucosamine 3-sulfate}}
{{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}}
 
{{#set: molecular-weight=152.112}}
 

Revision as of 08:25, 15 March 2021

Metabolite HEPARIN-GLUCOSAMINE-3-O-SULFATE

  • common-name:
    • a [heparan sulfate]-α-d-glucosamine 3-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [heparan sulfate]-α-d-glucosamine 3-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.