Difference between revisions of "CPD-18539"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2108 == * common-name: ** (2e)-oct-2-enoyl-coa * smiles: ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op...") |
(Created page with "Category:metabolite == Metabolite CPD-2751 == * common-name: ** 5'-hydroxycotinine * smiles: ** c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2)) * inchi-key: ** bbnhnzgtkswihd-snvbaglbs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-2751 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-hydroxycotinine |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bbnhnzgtkswihd-snvbaglbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 192.217 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-163]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-hydroxycotinine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bbnhnzgtkswihd-snvbaglbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=192.217}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-2751
- common-name:
- 5'-hydroxycotinine
- smiles:
- c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2))
- inchi-key:
- bbnhnzgtkswihd-snvbaglbsa-n
- molecular-weight:
- 192.217
