Difference between revisions of "CPD-14268"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METHIONYL-PEPTIDE == * common-name: ** an n-terminal l-methionyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-7418 == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] * inchi-key: ** pmowtihvnwzyfi-waywqwqtsa-m * molec...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7418 == |
* common-name: | * common-name: | ||
− | ** | + | ** coumarinate |
+ | * smiles: | ||
+ | ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** pmowtihvnwzyfi-waywqwqtsa-m | ||
+ | * molecular-weight: | ||
+ | ** 163.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8036]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=coumarinate}} |
+ | {{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}} | ||
+ | {{#set: molecular-weight=163.152}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-7418
- common-name:
- coumarinate
- smiles:
- c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
- inchi-key:
- pmowtihvnwzyfi-waywqwqtsa-m
- molecular-weight:
- 163.152