Difference between revisions of "CPD-14268"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHIONYL-PEPTIDE == * common-name: ** an n-terminal l-methionyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-7418 == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] * inchi-key: ** pmowtihvnwzyfi-waywqwqtsa-m * molec...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METHIONYL-PEPTIDE ==
+
== Metabolite CPD-7418 ==
 
* common-name:
 
* common-name:
** an n-terminal l-methionyl-[protein]
+
** coumarinate
 +
* smiles:
 +
** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
 +
* inchi-key:
 +
** pmowtihvnwzyfi-waywqwqtsa-m
 +
* molecular-weight:
 +
** 163.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.5.1.88-RXN]]
+
* [[RXN-8036]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal l-methionyl-[protein]}}
+
{{#set: common-name=coumarinate}}
 +
{{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}}
 +
{{#set: molecular-weight=163.152}}

Revision as of 08:25, 15 March 2021

Metabolite CPD-7418

  • common-name:
    • coumarinate
  • smiles:
    • c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
  • inchi-key:
    • pmowtihvnwzyfi-waywqwqtsa-m
  • molecular-weight:
    • 163.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality