Difference between revisions of "Glucuronosylated-Glucuronoside-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * inchi-key: ** odblhexud...")
(Created page with "Category:metabolite == Metabolite CPD-9898 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THREO-DS-ISO-CITRATE ==
+
== Metabolite CPD-9898 ==
 
* common-name:
 
* common-name:
** d-threo-isocitrate
+
** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
 
* smiles:
 
* smiles:
** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** odblhexudapzau-zafykaaxsa-k
+
** fdppbyxdoxrdha-jsgwljpksa-m
 
* molecular-weight:
 
* molecular-weight:
** 189.101
+
** 780.205
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEHYDR-RXN]]
 
* [[ISOCIT-CLEAV-RXN]]
 
* [[ISOCITDEH-RXN]]
 
* [[RXN-14047]]
 
* [[RXN-9951]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEHYDR-RXN]]
+
* [[RXN-9281]]
* [[ISOCIT-CLEAV-RXN]]
 
* [[ISOCITDEH-RXN]]
 
* [[RXN-14047]]
 
* [[RXN-9951]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-threo-isocitrate}}
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}}
{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}
+
{{#set: inchi-key=inchikey=fdppbyxdoxrdha-jsgwljpksa-m}}
{{#set: molecular-weight=189.101}}
+
{{#set: molecular-weight=780.205}}

Revision as of 08:25, 15 March 2021

Metabolite CPD-9898

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • fdppbyxdoxrdha-jsgwljpksa-m
  • molecular-weight:
    • 780.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality