Difference between revisions of "CPD-11520"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3187 == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2)) * inchi-key: ** boqrppfuushfgw-snvbaglbsa...") |
(Created page with "Category:metabolite == Metabolite Poly-Hydroxybutyrate == * common-name: ** poly-3-hydroxybutanoate == Reaction(s) known to consume the compound == * 3.1.1.75-RXN == R...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Poly-Hydroxybutyrate == |
* common-name: | * common-name: | ||
− | ** | + | ** poly-3-hydroxybutanoate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.1.1.75-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.1.1.75-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=poly-3-hydroxybutanoate}} |
− | |||
− |
Revision as of 08:26, 15 March 2021
Contents
Metabolite Poly-Hydroxybutyrate
- common-name:
- poly-3-hydroxybutanoate