Difference between revisions of "CPD-11520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3187 == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2)) * inchi-key: ** boqrppfuushfgw-snvbaglbsa...")
(Created page with "Category:metabolite == Metabolite Poly-Hydroxybutyrate == * common-name: ** poly-3-hydroxybutanoate == Reaction(s) known to consume the compound == * 3.1.1.75-RXN == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3187 ==
+
== Metabolite Poly-Hydroxybutyrate ==
 
* common-name:
 
* common-name:
** 2'-hydroxynicotine
+
** poly-3-hydroxybutanoate
* smiles:
 
** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2))
 
* inchi-key:
 
** boqrppfuushfgw-snvbaglbsa-o
 
* molecular-weight:
 
** 179.241
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.1.75-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-146]]
+
* [[3.1.1.75-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-hydroxynicotine}}
+
{{#set: common-name=poly-3-hydroxybutanoate}}
{{#set: inchi-key=inchikey=boqrppfuushfgw-snvbaglbsa-o}}
 
{{#set: molecular-weight=179.241}}
 

Revision as of 08:26, 15 March 2021

Metabolite Poly-Hydroxybutyrate

  • common-name:
    • poly-3-hydroxybutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality