Difference between revisions of "CPD-8564"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1-ARSENATE == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) * inchi-key: ** ryjjomqpaa...")
(Created page with "Category:metabolite == Metabolite CPD0-1163 == * common-name: ** (s)-3-hydroxy-(5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOSE-1-ARSENATE ==
+
== Metabolite CPD0-1163 ==
 
* common-name:
 
* common-name:
** ribose-1-arsenate
+
** (s)-3-hydroxy-(5z)-tetradecenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
+
** ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** ryjjomqpaaufbf-txicztdvsa-l
+
** kjjpuifalmaqpf-suakzgbesa-j
 
* molecular-weight:
 
* molecular-weight:
** 272.043
+
** 987.845
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14393]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7001]]
+
* [[RXN-14393]]
 +
* [[RXN0-5393]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ribose-1-arsenate}}
+
{{#set: common-name=(s)-3-hydroxy-(5z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}}
+
{{#set: inchi-key=inchikey=kjjpuifalmaqpf-suakzgbesa-j}}
{{#set: molecular-weight=272.043}}
+
{{#set: molecular-weight=987.845}}

Revision as of 08:26, 15 March 2021

Metabolite CPD0-1163

  • common-name:
    • (s)-3-hydroxy-(5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • kjjpuifalmaqpf-suakzgbesa-j
  • molecular-weight:
    • 987.845

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality