Difference between revisions of "CPD-8355"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 10-FORMYL-THF == * common-name: ** 10-formyl-tetrahydrofolate mono-l-glutamate * smiles: ** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc(...") |
(Created page with "Category:metabolite == Metabolite CPD-13393 == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=o)c[n+] * inchi-key: ** pfmuccyyaafkth-yfkpbyrvsa-n *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13393 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-methionine |
* smiles: | * smiles: | ||
| − | ** | + | ** csccc(c(=o)[o-])nc(=o)c[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pfmuccyyaafkth-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 206.259 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6974]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-methionine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=206.259}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-13393
- common-name:
- glycyl-l-methionine
- smiles:
- csccc(c(=o)[o-])nc(=o)c[n+]
- inchi-key:
- pfmuccyyaafkth-yfkpbyrvsa-n
- molecular-weight:
- 206.259
