Difference between revisions of "5-HYDROXY-FERULIC-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL == * common-name: ** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc...")
(Created page with "Category:metabolite == Metabolite GLUTATHIONE == * common-name: ** glutathione * smiles: ** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** rwsxrvcmgqzwbv-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL ==
+
== Metabolite GLUTATHIONE ==
 
* common-name:
 
* common-name:
−
** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
+
** glutathione
 
* smiles:
 
* smiles:
−
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
+
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** zagwhopypmukok-fricuitqsa-n
+
** rwsxrvcmgqzwbv-wdskdsinsa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 548.848
+
** 306.313
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN3O-54]]
+
* [[1.11.1.12-RXN]]
 +
* [[1.8.4.9-RXN]]
 +
* [[1.8.5.1-RXN]]
 +
* [[2.3.2.15-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GSHTRAN-RXN]]
 +
* [[GST-RXN]]
 +
* [[GTHP]]
 +
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 +
* [[RXN-12618]]
 +
* [[RXN-13673]]
 +
* [[RXN-15680]]
 +
* [[RXN-18092]]
 +
* [[RXN-6601]]
 +
* [[RXN-9157]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GDR]]
 +
* [[GDR_LPAREN_nadp_RPAREN_]]
 +
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GDRh]]
 +
* [[GDRm]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GLYOXII-RXN]]
 +
* [[GST-RXN]]
 +
* [[RXN-13161]]
 +
* [[RXN-7919]]
 +
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=glutathione}}
−
{{#set: inchi-key=inchikey=zagwhopypmukok-fricuitqsa-n}}
+
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
−
{{#set: molecular-weight=548.848}}
+
{{#set: molecular-weight=306.313}}

Revision as of 08:26, 15 March 2021

Metabolite GLUTATHIONE

  • common-name:
    • glutathione
  • smiles:
    • c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • rwsxrvcmgqzwbv-wdskdsinsa-m
  • molecular-weight:
    • 306.313

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-HYDROXY-FERULIC-ACID&oldid=124520"