Difference between revisions of "CPD-1081"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-12601 == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-rwopyejcsa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12601 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-mannopyranose |
| + | * smiles: | ||
| + | ** c(o)c1(c(o)c(o)c(o)c(o)o1) | ||
| + | * inchi-key: | ||
| + | ** wqzgkkkjijffok-rwopyejcsa-n | ||
| + | * molecular-weight: | ||
| + | ** 180.157 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-mannopyranose}} |
| + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}} | ||
| + | {{#set: molecular-weight=180.157}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-12601
- common-name:
- β-d-mannopyranose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o)o1)
- inchi-key:
- wqzgkkkjijffok-rwopyejcsa-n
- molecular-weight:
- 180.157
