Difference between revisions of "GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...")
(Created page with "Category:metabolite == Metabolite i-Antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CINNAMOYL-COA ==
+
== Metabolite i-Antigens ==
 
* common-name:
 
* common-name:
** (e)-cinnamoyl-coa
+
** an i antigen
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** jvnvhnhitfvwix-kzkudurgsa-j
 
* molecular-weight:
 
** 893.648
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7645]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2001]]
+
* [[RXN-15276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-cinnamoyl-coa}}
+
{{#set: common-name=an i antigen}}
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
 
{{#set: molecular-weight=893.648}}
 

Revision as of 08:26, 15 March 2021

Metabolite i-Antigens

  • common-name:
    • an i antigen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality