Difference between revisions of "CPD-4568"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13576 == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * smiles: ** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)...") |
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LIOTHYRONINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,5,3'-triiodo-l-thyronine |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** auyycjsjgjycds-lbprgkrzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 650.978 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10607]] |
| + | * [[RXN-10609]] | ||
| + | * [[RXN-10615]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=650.978}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite LIOTHYRONINE
- common-name:
- 3,5,3'-triiodo-l-thyronine
- smiles:
- c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
- inchi-key:
- auyycjsjgjycds-lbprgkrzsa-n
- molecular-weight:
- 650.978
