Difference between revisions of "HSCN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...")
(Created page with "Category:metabolite == Metabolite CPD-2752 == * common-name: ** trans-3-hydroxycotinine-glucuronide * smiles: ** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TAGATOSE-1-6-DIPHOSPHATE ==
+
== Metabolite CPD-2752 ==
 
* common-name:
 
* common-name:
** d-tagatofuranose 1,6-bisphosphate
+
** trans-3-hydroxycotinine-glucuronide
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
+
** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
 
* inchi-key:
 
* inchi-key:
** rnbgygvwrkecfj-oexcpvawsa-j
+
** walnnkzughysct-mbwyjtgfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 367.335
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TAGAALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TAGAKIN-RXN]]
+
* [[RXN66-162]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
+
{{#set: common-name=trans-3-hydroxycotinine-glucuronide}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
+
{{#set: inchi-key=inchikey=walnnkzughysct-mbwyjtgfsa-m}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=367.335}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-2752

  • common-name:
    • trans-3-hydroxycotinine-glucuronide
  • smiles:
    • c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
  • inchi-key:
    • walnnkzughysct-mbwyjtgfsa-m
  • molecular-weight:
    • 367.335

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality