Difference between revisions of "5-HYDROXYINDOLE ACETALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7630 == * common-name: ** (-)-epicatechin * smiles: ** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o) * inchi-key: ** pftawblqpzve...")
(Created page with "Category:metabolite == Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE == * common-name: ** (r)-1-amino-2-propanol o-2-phosphate * smiles: ** cc(c[n+])op(=o)([o-])[o-] * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7630 ==
+
== Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE ==
 
* common-name:
 
* common-name:
** (-)-epicatechin
+
** (r)-1-amino-2-propanol o-2-phosphate
 
* smiles:
 
* smiles:
** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o)
+
** cc(c[n+])op(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** pftawblqpzvemu-ukrrqhhqsa-n
+
** ybolzujjguzudc-gsvougtgsa-m
 
* molecular-weight:
 
* molecular-weight:
** 290.272
+
** 154.082
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9725]]
+
* [[4.1.1.81-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-epicatechin}}
+
{{#set: common-name=(r)-1-amino-2-propanol o-2-phosphate}}
{{#set: inchi-key=inchikey=pftawblqpzvemu-ukrrqhhqsa-n}}
+
{{#set: inchi-key=inchikey=ybolzujjguzudc-gsvougtgsa-m}}
{{#set: molecular-weight=290.272}}
+
{{#set: molecular-weight=154.082}}

Revision as of 08:26, 15 March 2021

Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE

  • common-name:
    • (r)-1-amino-2-propanol o-2-phosphate
  • smiles:
    • cc(c[n+])op(=o)([o-])[o-]
  • inchi-key:
    • ybolzujjguzudc-gsvougtgsa-m
  • molecular-weight:
    • 154.082

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality