Difference between revisions of "1-Alkyl-2-acyl-glycerol"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-170 == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine32 == * common-name: ** a pseudouridine32 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-170 ==
+
== Metabolite tRNA-pseudouridine32 ==
 
* common-name:
 
* common-name:
** stachyose
+
** a pseudouridine32 in trna
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
 
* inchi-key:
 
** uqziybxshagnoe-xnsrjbnmsa-n
 
* molecular-weight:
 
** 666.583
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.67-RXN]]
 
* [[RXN-11501]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.67-RXN]]
+
* [[RXN-11842]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=stachyose}}
+
{{#set: common-name=a pseudouridine32 in trna}}
{{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}}
 
{{#set: molecular-weight=666.583}}
 

Revision as of 08:27, 15 March 2021

Metabolite tRNA-pseudouridine32

  • common-name:
    • a pseudouridine32 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality