Difference between revisions of "CPD-712"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol == * common-name: ** a 2-acyl-1-alkyl-sn-glycerol == Reaction(s) known to consume the compound == * RXN-17731...") |
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GAMA-TOCOPHEROL == |
* common-name: | * common-name: | ||
− | ** | + | ** γ-tocopherol |
+ | * smiles: | ||
+ | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) | ||
+ | * inchi-key: | ||
+ | ** quedxnhftdjviy-dqczwyhmsa-n | ||
+ | * molecular-weight: | ||
+ | ** 416.686 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-tocopherol}} |
+ | {{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}} | ||
+ | {{#set: molecular-weight=416.686}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite GAMA-TOCOPHEROL
- common-name:
- γ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
- inchi-key:
- quedxnhftdjviy-dqczwyhmsa-n
- molecular-weight:
- 416.686