Difference between revisions of "CPD-474"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-methionyl-tRNAfmet == * common-name: ** an l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compound == * METHIONY...")
(Created page with "Category:metabolite == Metabolite CPD-13188 == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-methionyl-tRNAfmet ==
+
== Metabolite CPD-13188 ==
 
* common-name:
 
* common-name:
** an l-methionyl-[initiator trnamet]
+
** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
 +
* smiles:
 +
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
 +
* inchi-key:
 +
** cwvrqjbcbctflt-civpzrojsa-n
 +
* molecular-weight:
 +
** 488.442
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16165]]
+
* [[RXN-12270]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-methionyl-[initiator trnamet]}}
+
{{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}}
 +
{{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}}
 +
{{#set: molecular-weight=488.442}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-13188

  • common-name:
    • β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
  • smiles:
    • cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
  • inchi-key:
    • cwvrqjbcbctflt-civpzrojsa-n
  • molecular-weight:
    • 488.442

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality