Difference between revisions of "DNA-with-mismatch"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1099 == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) * inchi-key...")
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1099 ==
+
== Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET ==
 
* common-name:
 
* common-name:
** raffinose
+
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
 
* smiles:
 
* smiles:
** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
+
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** mupfekgtmrgplj-zqskzdjdsa-n
+
** htjxtkbiuvfuar-xhibxcghsa-j
 
* molecular-weight:
 
* molecular-weight:
** 504.441
+
** 597.259
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.67-RXN]]
+
* [[RXN0-302]]
* [[RXN-11502]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.67-RXN]]
+
* [[2.7.1.148-RXN]]
* [[2.4.1.82-RXN]]
 
* [[RXN-11501]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=raffinose}}
+
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
{{#set: inchi-key=inchikey=mupfekgtmrgplj-zqskzdjdsa-n}}
+
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
{{#set: molecular-weight=504.441}}
+
{{#set: molecular-weight=597.259}}

Revision as of 08:27, 15 March 2021

Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET

  • common-name:
    • 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
  • smiles:
    • cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
  • inchi-key:
    • htjxtkbiuvfuar-xhibxcghsa-j
  • molecular-weight:
    • 597.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality