Difference between revisions of "CH3-MALONATE-S-ALD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4822 == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]...")
(Created page with "Category:metabolite == Metabolite CPD-15709 == * common-name: ** keto-d-fructose 6-phosphate == Reaction(s) known to consume the compound == * RXN-14812 == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4822 ==
+
== Metabolite CPD-15709 ==
 
* common-name:
 
* common-name:
** kanamycin b
+
** keto-d-fructose 6-phosphate
* smiles:
 
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
** skklouvuunmcje-fqsmhnglsa-s
 
* molecular-weight:
 
** 488.557
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14553]]
+
* [[RXN-14812]]
* [[RXN-15287]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14812]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin b}}
+
{{#set: common-name=keto-d-fructose 6-phosphate}}
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
 
{{#set: molecular-weight=488.557}}
 

Revision as of 08:28, 15 March 2021

Metabolite CPD-15709

  • common-name:
    • keto-d-fructose 6-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality