Difference between revisions of "3Z-PHYTOCHROMOBILIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17319 == * common-name: ** 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate * smiles: ** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cc...") |
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yszsvgfmajxgmq-fricuitqsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 575.85 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.1.1.114-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=575.85}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
- inchi-key:
- yszsvgfmajxgmq-fricuitqsa-m
- molecular-weight:
- 575.85
