Difference between revisions of "CPD-8075"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8075 == * common-name: ** 1-18:2-2-16:1-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
(Created page with "Category:metabolite == Metabolite Glc2Man9GlcNAc2-proteins == * common-name: ** glc2man9glcnac2-[protein] == Reaction(s) known to consume the compound == == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8075 ==
+
== Metabolite Glc2Man9GlcNAc2-proteins ==
 
* common-name:
 
* common-name:
** 1-18:2-2-16:1-monogalactosyldiacylglycerol
+
** glc2man9glcnac2-[protein]
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
 
* inchi-key:
 
** hghvcqzwrzwqks-cphkdgevsa-n
 
* molecular-weight:
 
** 753.067
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8297]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.106-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-16:1-monogalactosyldiacylglycerol}}
+
{{#set: common-name=glc2man9glcnac2-[protein]}}
{{#set: inchi-key=inchikey=hghvcqzwrzwqks-cphkdgevsa-n}}
 
{{#set: molecular-weight=753.067}}
 

Revision as of 08:28, 15 March 2021

Metabolite Glc2Man9GlcNAc2-proteins

  • common-name:
    • glc2man9glcnac2-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "glc2man9glcnac2-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.