Difference between revisions of "Pre-tRNA-5-prime-half-molecules"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-401 == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) * inchi-key: ** myyiahxivfadcu-qmmmgpobsa-n * mo...")
(Created page with "Category:metabolite == Metabolite DIHYDROPTERIN-CH2OH-PP == * common-name: ** (7,8-dihydropterin-6-yl)methyl diphosphate * smiles: ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-401 ==
+
== Metabolite DIHYDROPTERIN-CH2OH-PP ==
 
* common-name:
 
* common-name:
** anserine
+
** (7,8-dihydropterin-6-yl)methyl diphosphate
 
* smiles:
 
* smiles:
** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o)
+
** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
 
* inchi-key:
 
* inchi-key:
** myyiahxivfadcu-qmmmgpobsa-n
+
** fcqgjglsowzzon-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 240.261
+
** 352.116
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[X-METHYL-HIS-DIPEPTIDASE-RXN]]
+
* [[H2PTEROATESYNTH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
+
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=anserine}}
+
{{#set: common-name=(7,8-dihydropterin-6-yl)methyl diphosphate}}
{{#set: inchi-key=inchikey=myyiahxivfadcu-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=fcqgjglsowzzon-uhfffaoysa-k}}
{{#set: molecular-weight=240.261}}
+
{{#set: molecular-weight=352.116}}

Revision as of 08:28, 15 March 2021

Metabolite DIHYDROPTERIN-CH2OH-PP

  • common-name:
    • (7,8-dihydropterin-6-yl)methyl diphosphate
  • smiles:
    • c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
  • inchi-key:
    • fcqgjglsowzzon-uhfffaoysa-k
  • molecular-weight:
    • 352.116

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality