Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...")
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPDQT-39 ==
+
== Metabolite GTP ==
 
* common-name:
 
* common-name:
** 3-[(6'-methylthio)hexyl]malate
+
** gtp
 
* smiles:
 
* smiles:
** csccccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** lqqzhlhcfscjcu-uhfffaoysa-l
+
** xkmlyualxhknft-uuokfmhzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 262.32
+
** 519.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18202]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[RXNQT-4174]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
* [[FE2GTPabc]]
 +
* [[GTCY]]
 +
* [[GTP-CYCLOHYDRO-I-RXN]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
* [[GTPPYPHOSKIN-RXN]]
 +
* [[GTUP]]
 +
* [[GUANYLCYC-RXN]]
 +
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[NTDP]]
 +
* [[RXN-12502]]
 +
* [[RXN-12504]]
 +
* [[RXN-14140]]
 +
* [[RXN-14201]]
 +
* [[RXN-15713]]
 +
* [[RXN-17921]]
 +
* [[RXN-8340]]
 +
* [[RXN-8988]]
 +
* [[RXN0-5462]]
 +
* [[RXN0-746]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[URKI-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18202]]
+
* [[3.6.1.17-RXN]]
 +
* [[ATGD]]
 +
* [[GDPKIN-RXN]]
 +
* [[GTPOP]]
 +
* [[RXN-14117]]
 +
* [[RXN0-6427]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(6'-methylthio)hexyl]malate}}
+
{{#set: common-name=gtp}}
{{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
{{#set: molecular-weight=262.32}}
+
{{#set: molecular-weight=519.151}}

Revision as of 08:28, 15 March 2021