Difference between revisions of "Oxo-glutarate-dehydrogenase-DH-lipoyl"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-725 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** 13(s)-hpote |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uyqgvdxdxbaabn-fqsphkrjsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 309.425 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1F-19]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-1321]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=13(s)-hpote}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uyqgvdxdxbaabn-fqsphkrjsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=309.425}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-725
- common-name:
- 13(s)-hpote
- smiles:
- ccc=ccc(c=cc=ccccccccc([o-])=o)oo
- inchi-key:
- uyqgvdxdxbaabn-fqsphkrjsa-m
- molecular-weight:
- 309.425