Difference between revisions of "Nucleoside-Diphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYSTEARATE == * common-name: ** (r)-2-hydroxystearate * smiles: ** ccccccccccccccccc(o)c(=o)[o-] * inchi-key: ** kihbgtrzfavzrv-...")
(Created page with "Category:metabolite == Metabolite CPD-14594 == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** fersmfqb...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite R-2-HYDROXYSTEARATE ==
+
== Metabolite CPD-14594 ==
 
* common-name:
 
* common-name:
** (r)-2-hydroxystearate
+
** linustatin
 
* smiles:
 
* smiles:
** ccccccccccccccccc(o)c(=o)[o-]
+
** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
 
* inchi-key:
 
* inchi-key:
** kihbgtrzfavzrv-qgzvfwflsa-m
+
** fersmfqbwvbkqk-cxttvelosa-n
 
* molecular-weight:
 
* molecular-weight:
** 299.473
+
** 409.389
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
+
* [[RXN-13602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
 
* [[RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-2-hydroxystearate}}
+
{{#set: common-name=linustatin}}
{{#set: inchi-key=inchikey=kihbgtrzfavzrv-qgzvfwflsa-m}}
+
{{#set: inchi-key=inchikey=fersmfqbwvbkqk-cxttvelosa-n}}
{{#set: molecular-weight=299.473}}
+
{{#set: molecular-weight=409.389}}

Revision as of 08:29, 15 March 2021

Metabolite CPD-14594

  • common-name:
    • linustatin
  • smiles:
    • cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
  • inchi-key:
    • fersmfqbwvbkqk-cxttvelosa-n
  • molecular-weight:
    • 409.389

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality