Difference between revisions of "CPD-725"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite L-Glutamyl-Peptides == * common-name: ** an n-terminal l-glutamyl-[protein] == Reaction(s) known to consume the compound == * RXN-17888...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE ==
+
== Metabolite L-Glutamyl-Peptides ==
 
* common-name:
 
* common-name:
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
+
** an n-terminal l-glutamyl-[protein]
* smiles:
 
** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
 
* inchi-key:
 
** swkaczqjgxabcn-jsgwljpksa-n
 
* molecular-weight:
 
** 737.203
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2762]]
+
* [[RXN-17888]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2761]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=an n-terminal l-glutamyl-[protein]}}
{{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}}
 
{{#set: molecular-weight=737.203}}
 

Revision as of 08:29, 15 March 2021

Metabolite L-Glutamyl-Peptides

  • common-name:
    • an n-terminal l-glutamyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-glutamyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.