Difference between revisions of "B-Gal-14-NacGlc-R"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite m7G5-pppm6Am-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna] == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite CPD66-21 == * common-name: ** leukotriene-d4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite m7G5-pppm6Am-mRNAs ==
+
== Metabolite CPD66-21 ==
 
* common-name:
 
* common-name:
** a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna]
+
** leukotriene-d4
 +
* smiles:
 +
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o
 +
* inchi-key:
 +
** yeeskjgwjfyook-ijhyuljssa-m
 +
* molecular-weight:
 +
** 495.653
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.62-RXN]]
+
* [[RXN66-336]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-(n7-methyl 5'-triphosphoguanosine)-(n6,2'-o-dimethyladenosine)-[mrna]}}
+
{{#set: common-name=leukotriene-d4}}
 +
{{#set: inchi-key=inchikey=yeeskjgwjfyook-ijhyuljssa-m}}
 +
{{#set: molecular-weight=495.653}}

Revision as of 08:29, 15 March 2021

Metabolite CPD66-21

  • common-name:
    • leukotriene-d4
  • smiles:
    • cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o
  • inchi-key:
    • yeeskjgwjfyook-ijhyuljssa-m
  • molecular-weight:
    • 495.653

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality