Difference between revisions of "Trans-3-cis-5-dienoyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Beta-Lactams == * common-name: ** a β-lactam == Reaction(s) known to consume the compound == * BETA-LACTAMASE-RXN == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Beta-Lactams == |
* common-name: | * common-name: | ||
| − | ** | + | ** a β-lactam |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BETA-LACTAMASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a β-lactam}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite Beta-Lactams
- common-name:
- a β-lactam
