Difference between revisions of "NARINGENIN-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-195 == * common-name: ** octanoate * smiles: ** cccccccc(=o)[o-] * inchi-key: ** wwzkqhockizlma-uhfffaoysa-m * molecular-weight: ** 1...") |
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-5821 == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline |
* smiles: | * smiles: | ||
− | ** | + | ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** whkyncpixmntrq-yfkpbyrvsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 201.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-6201]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[3. | + | * [[3.5.2.17-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=whkyncpixmntrq-yfkpbyrvsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=201.118}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-5821
- common-name:
- (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
- smiles:
- c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
- inchi-key:
- whkyncpixmntrq-yfkpbyrvsa-m
- molecular-weight:
- 201.118