Difference between revisions of "N-ACETYL-SEROTONIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](cccc(c(c([o-])=o)[n+])o...")
(Created page with "Category:metabolite == Metabolite PHE-tRNAs == * common-name: ** a trnaphe == Reaction(s) known to consume the compound == * PHENYLALANINE--TRNA-LIGASE-RXN == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE ==
+
== Metabolite PHE-tRNAs ==
 
* common-name:
 
* common-name:
** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
+
** a trnaphe
* smiles:
 
** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
 
* inchi-key:
 
** zrjhlgyvucpznh-mqwkrirwsa-o
 
* molecular-weight:
 
** 205.276
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9896]]
+
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=a trnaphe}}
{{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}}
 
{{#set: molecular-weight=205.276}}
 

Revision as of 08:29, 15 March 2021

Metabolite PHE-tRNAs

  • common-name:
    • a trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality