Difference between revisions of "IMIDAZOLE ACETALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...") |
(Created page with "Category:metabolite == Metabolite PALMITATE == * common-name: ** palmitate * smiles: ** cccccccccccccccc([o-])=o * inchi-key: ** ipcsvzssvzvige-uhfffaoysa-m * molecular-we...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PALMITATE == |
* common-name: | * common-name: | ||
− | ** | + | ** palmitate |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ipcsvzssvzvige-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 255.42 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[FATTY-ACID-PEROXIDASE-RXN]] |
− | + | * [[RXN-9623]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.1.1.64-RXN]] |
− | * [[ | + | * [[3.1.2.22-RXN]] |
− | * [[ | + | * [[PALMITOYL-COA-HYDROLASE-RXN]] |
− | * [[ | + | * [[RETINYL-PALMITATE-ESTERASE-RXN]] |
− | * [[ | + | * [[RXN-12430]] |
− | * [[ | + | * [[RXN-15065]] |
− | * [[ | + | * [[RXN-16655]] |
− | * [[RXN- | + | * [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]] |
+ | * [[RXN-9549]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=palmitate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ipcsvzssvzvige-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.42}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite PALMITATE
- common-name:
- palmitate
- smiles:
- cccccccccccccccc([o-])=o
- inchi-key:
- ipcsvzssvzvige-uhfffaoysa-m
- molecular-weight:
- 255.42
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 3.1.1.64-RXN
- 3.1.2.22-RXN
- PALMITOYL-COA-HYDROLASE-RXN
- RETINYL-PALMITATE-ESTERASE-RXN
- RXN-12430
- RXN-15065
- RXN-16655
- RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.
- RXN-9549