Difference between revisions of "L-EPINEPHRINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15663 == * common-name: ** 2-trans-nonenoyl-coa * smiles: ** ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
(Created page with "Category:metabolite == Metabolite Tau-proteins == * common-name: ** a tau protein == Reaction(s) known to consume the compound == * TAU-PROTEIN-KINASE-RXN == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15663 ==
+
== Metabolite Tau-proteins ==
 
* common-name:
 
* common-name:
** 2-trans-nonenoyl-coa
+
** a tau protein
* smiles:
 
** ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** hblotzdypzazle-owqwvslfsa-j
 
* molecular-weight:
 
** 901.711
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14794]]
+
* [[TAU-PROTEIN-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14793]]
+
* [[TAU-PROTEIN-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans-nonenoyl-coa}}
+
{{#set: common-name=a tau protein}}
{{#set: inchi-key=inchikey=hblotzdypzazle-owqwvslfsa-j}}
 
{{#set: molecular-weight=901.711}}
 

Revision as of 08:30, 15 March 2021

Metabolite Tau-proteins

  • common-name:
    • a tau protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality