Difference between revisions of "CD-SP-2Fe2S-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MYO-INOSITOL == * common-name: ** myo-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaismweouebre-gpivlxjgsa-n * molecu...")
(Created page with "Category:metabolite == Metabolite CPD-19168 == * common-name: ** (s)-3-hydroxy-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MYO-INOSITOL ==
+
== Metabolite CPD-19168 ==
 
* common-name:
 
* common-name:
** myo-inositol
+
** (s)-3-hydroxy-(7z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** c1(c(c(c(c(c1o)o)o)o)o)o
+
** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** cdaismweouebre-gpivlxjgsa-n
+
** kzlhpkriedlqgg-squpixldsa-j
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 1015.898
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.123-RXN]]
+
* [[RXN-17781]]
* [[2.4.1.67-RXN]]
 
* [[2.7.8.11-RXN]]
 
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 
* [[MYO-INOSITOL-OXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.67-RXN]]
+
* [[RXN-17780]]
* [[2.4.1.82-RXN]]
 
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 
* [[RXN-10949]]
 
* [[RXN-10952]]
 
* [[RXN-10953]]
 
* [[RXN-10954]]
 
* [[RXN-7253]]
 
* [[RXN-8281]]
 
* [[RXN0-5408]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=myo-inositol}}
+
{{#set: common-name=(s)-3-hydroxy-(7z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=cdaismweouebre-gpivlxjgsa-n}}
+
{{#set: inchi-key=inchikey=kzlhpkriedlqgg-squpixldsa-j}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=1015.898}}

Revision as of 08:30, 15 March 2021

Metabolite CPD-19168

  • common-name:
    • (s)-3-hydroxy-(7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kzlhpkriedlqgg-squpixldsa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality