Difference between revisions of "TRNA-Containing-N7-Methylguanine-46"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Lysidine-tRNA-Ile2 == * common-name: ** a lysidine34 in trnaile2 == Reaction(s) known to consume the compound == == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite CPD-13853 == * common-name: ** 8-oxo-dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inch...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13853 == |
* common-name: | * common-name: | ||
− | ** | + | ** 8-oxo-dgdp |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** ljmltzsnwocynq-vpeninkcsa-k | ||
+ | * molecular-weight: | ||
+ | ** 440.179 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12816]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=8-oxo-dgdp}} |
+ | {{#set: inchi-key=inchikey=ljmltzsnwocynq-vpeninkcsa-k}} | ||
+ | {{#set: molecular-weight=440.179}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-13853
- common-name:
- 8-oxo-dgdp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- ljmltzsnwocynq-vpeninkcsa-k
- molecular-weight:
- 440.179