Difference between revisions of "CPD1G-332"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CDP-2-3-4-Saturated-Diacylglycerols == * common-name: ** a cdp-2,3,4-saturated-diacylglycerol == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite L-BETA-ASPARTYL-P == * common-name: ** l-aspartyl-4-phosphate * smiles: ** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-] * inchi-key: ** ixznk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-BETA-ASPARTYL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-aspartyl-4-phosphate |
| + | * smiles: | ||
| + | ** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** ixznktpiykdigg-reohclbhsa-l | ||
| + | * molecular-weight: | ||
| + | ** 211.068 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
| + | * [[ASPARTATEKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] |
| + | * [[ASPARTATEKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-aspartyl-4-phosphate}} |
| + | {{#set: inchi-key=inchikey=ixznktpiykdigg-reohclbhsa-l}} | ||
| + | {{#set: molecular-weight=211.068}} | ||
Revision as of 08:31, 15 March 2021
Contents
Metabolite L-BETA-ASPARTYL-P
- common-name:
- l-aspartyl-4-phosphate
- smiles:
- c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-]
- inchi-key:
- ixznktpiykdigg-reohclbhsa-l
- molecular-weight:
- 211.068
