Difference between revisions of "CPD-17539"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11400 == * common-name: ** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=...")
(Created page with "Category:metabolite == Metabolite CPD-415 == * common-name: ** a 1-long-chain acyl-glycerone 3-phosphate == Reaction(s) known to consume the compound == * ALKYLGLYCERONE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11400 ==
+
== Metabolite CPD-415 ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
+
** a 1-long-chain acyl-glycerone 3-phosphate
* smiles:
 
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
 
* inchi-key:
 
** yyfgggcinngole-zdxogfqlsa-m
 
* molecular-weight:
 
** 826.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10607]]
+
* [[2.3.1.42-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide}}
+
{{#set: common-name=a 1-long-chain acyl-glycerone 3-phosphate}}
{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
 
{{#set: molecular-weight=826.095}}
 

Revision as of 08:31, 15 March 2021

Metabolite CPD-415

  • common-name:
    • a 1-long-chain acyl-glycerone 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality